C19H25FN2O4 — CID 92568520
4-[[(5S)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide (PubChem CID 92568520) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[[(5S)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide.
| Compound Name | 4-[[(5S)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 92568520 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[[(5S)-3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-N-(3-hydroxypropyl)oxane-4-carboxamide |
| SMILES | O=C(NCCCO)C1(C[C@H]2CC(c3cccc(F)c3)=NO2)CCOCC1 |
| InChI | InChI=1S/C19H25FN2O4/c20-15-4-1-3-14(11-15)17-12-16(26-22-17)13-19(5-9-25-10-6-19)18(24)21-7-2-8-23/h1,3-4,11,16,23H,2,5-10,12-13H2,(H,21,24)/t16-/m1/s1 |
| InChIKey | ZZOUXGOBJSDUCH-MRXNPFEDSA-N |
| XLogP | 2.00 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|