C18H24FN3O3 — CID 91946116
3-(3-fluorophenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide (PubChem CID 91946116) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91946116 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(3-fluorophenyl)-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC1(C(=O)NCCCN2CCOCC2)CC(c2cccc(F)c2)=NO1 |
| InChI | InChI=1S/C18H24FN3O3/c1-18(13-16(21-25-18)14-4-2-5-15(19)12-14)17(23)20-6-3-7-22-8-10-24-11-9-22/h2,4-5,12H,3,6-11,13H2,1H3,(H,20,23) |
| InChIKey | ZHAXGMZVSIKBOV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|