C18H22FN3O3 — CID 46096716
5-(3-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4-carboxamide (PubChem CID 46096716) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(3-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46096716 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-(3-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-c2cccc(F)c2)c1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H22FN3O3/c1-13-16(17(25-21-13)14-4-2-5-15(19)12-14)18(23)20-6-3-7-22-8-10-24-11-9-22/h2,4-5,12H,3,6-11H2,1H3,(H,20,23) |
| InChIKey | NWGPPBUDYGCSMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|