C31H40N4O4 — CID 143180178
3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide (PubChem CID 143180178) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 143180178 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-(3-morpholin-4-ylpropyl)-4H-1,2-oxazole-5-carboxamide |
| SMILES | CC1(C(=O)NCCCN2CCOCC2)CC(c2ccc(C(=O)N3CCC(Cc4ccccc4)CC3)cc2)=NO1 |
| InChI | InChI=1S/C31H40N4O4/c1-31(30(37)32-14-5-15-34-18-20-38-21-19-34)23-28(33-39-31)26-8-10-27(11-9-26)29(36)35-16-12-25(13-17-35)22-24-6-3-2-4-7-24/h2-4,6-11,25H,5,12-23H2,1H3,(H,32,37) |
| InChIKey | GMLZZLDXMZLLEW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|