C23H30N4O3 — CID 46954516
N-(3-imidazol-1-ylpropyl)-4-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]oxane-4-carboxamide (PubChem CID 46954516) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]oxane-4-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 46954516 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]oxane-4-carboxamide |
| SMILES | Cc1ccccc1C1=NOC(CC2(C(=O)NCCCn3ccnc3)CCOCC2)C1 |
| InChI | InChI=1S/C23H30N4O3/c1-18-5-2-3-6-20(18)21-15-19(30-26-21)16-23(7-13-29-14-8-23)22(28)25-9-4-11-27-12-10-24-17-27/h2-3,5-6,10,12,17,19H,4,7-9,11,13-16H2,1H3,(H,25,28) |
| InChIKey | HATZNPZWPDWHFH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|