C19H19FN4O2 — CID 90503433
1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-N-(3-imidazol-1-ylpropyl)cyclopropane-1-carboxamide (PubChem CID 90503433) has the molecular formula C19H19FN4O2 and a molecular weight of 354.38 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-N-(3-imidazol-1-ylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-N-(3-imidazol-1-ylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90503433 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-N-(3-imidazol-1-ylpropyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)C1(c2cc(-c3ccccc3F)on2)CC1 |
| InChI | InChI=1S/C19H19FN4O2/c20-15-5-2-1-4-14(15)16-12-17(23-26-16)19(6-7-19)18(25)22-8-3-10-24-11-9-21-13-24/h1-2,4-5,9,11-13H,3,6-8,10H2,(H,22,25) |
| InChIKey | SRAHMXFACKUONB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|