About 2-(2,2-dimethoxyethyl)aniline
2-(2,2-dimethoxyethyl)aniline (PubChem CID 11008551) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)aniline.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethyl)aniline |
| PubChem CID | 11008551 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)aniline |
| SMILES | COC(Cc1ccccc1N)OC |
| InChI | InChI=1S/C10H15NO2/c1-12-10(13-2)7-8-5-3-4-6-9(8)11/h3-6,10H,7,11H2,1-2H3 |
| InChIKey | KHUGROZNSAYXAF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethyl)aniline?
The IUPAC name of 2-(2,2-dimethoxyethyl)aniline (CID 11008551) is 2-(2,2-dimethoxyethyl)aniline.
What is the SMILES notation for 2-(2,2-dimethoxyethyl)aniline?
The canonical SMILES for 2-(2,2-dimethoxyethyl)aniline is COC(Cc1ccccc1N)OC.
What is the InChIKey of 2-(2,2-dimethoxyethyl)aniline?
The InChIKey is KHUGROZNSAYXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-12-10(13-2)7-8-5-3-4-6-9(8)11/h3-6,10H,7,11H2,1-2H3.
What are the key properties of 2-(2,2-dimethoxyethyl)aniline?
2-(2,2-dimethoxyethyl)aniline has a molecular weight of 181.23 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethyl)aniline is sourced from PubChem (CID 11008551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).