C18H23ClN4O2 — CID 110086157
4-[2-(5-chloro-2-methyl-1H-indol-3-yl)acetyl]-N,1-dimethylpiperazine-2-carboxamide (PubChem CID 110086157) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-methyl-1H-indol-3-yl)acetyl]-N,1-dimethylpiperazine-2-carboxamide.
| Compound Name | 4-[2-(5-chloro-2-methyl-1H-indol-3-yl)acetyl]-N,1-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 110086157 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[2-(5-chloro-2-methyl-1H-indol-3-yl)acetyl]-N,1-dimethylpiperazine-2-carboxamide |
| SMILES | CNC(=O)C1CN(C(=O)Cc2c(C)[nH]c3ccc(Cl)cc23)CCN1C |
| InChI | InChI=1S/C18H23ClN4O2/c1-11-13(14-8-12(19)4-5-15(14)21-11)9-17(24)23-7-6-22(3)16(10-23)18(25)20-2/h4-5,8,16,21H,6-7,9-10H2,1-3H3,(H,20,25) |
| InChIKey | FHDRNTSCWXEXDI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|