C22H23ClN2O3 — CID 113211983
2-(5-chloro-2-methyl-1H-indol-3-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 113211983) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1H-indol-3-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
| Compound Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 113211983 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)Cc1c(C)[nH]c3ccc(Cl)cc13)CC2 |
| InChI | InChI=1S/C22H23ClN2O3/c1-13-17(18-10-16(23)4-5-19(18)24-13)11-22(26)25-7-6-14-8-20(27-2)21(28-3)9-15(14)12-25/h4-5,8-10,24H,6-7,11-12H2,1-3H3 |
| InChIKey | QFVUINHBQPWFEC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|