C19H16F5NO3 — CID 18206374
1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 18206374) has the molecular formula C19H16F5NO3 and a molecular weight of 401.33 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 18206374 |
| Molecular Formula | C19H16F5NO3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)Cc1c(F)c(F)c(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C19H16F5NO3/c1-27-12-5-9-3-4-25(8-10(9)6-13(12)28-2)14(26)7-11-15(20)17(22)19(24)18(23)16(11)21/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | CLEOLQNNEYPFMY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|