C23H26N2O4 — CID 113212148
1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 113212148) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 113212148 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(5-methoxy-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N3CCc4cc(OC)c(OC)cc4C3)c2c1 |
| InChI | InChI=1S/C23H26N2O4/c1-14-18(19-11-17(27-2)5-6-20(19)24-14)12-23(26)25-8-7-15-9-21(28-3)22(29-4)10-16(15)13-25/h5-6,9-11,24H,7-8,12-13H2,1-4H3 |
| InChIKey | DWMKCUHUCBLNGH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|