C21H25ClN6 — CID 110097012
2-[[4-(3-chloroanilino)cyclohexyl]methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine (PubChem CID 110097012) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 2-[[4-(3-chloroanilino)cyclohexyl]methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine.
| Compound Name | 2-[[4-(3-chloroanilino)cyclohexyl]methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 110097012 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[[4-(3-chloroanilino)cyclohexyl]methyl]-N-(5-methyl-1H-pyrazol-3-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccnc(CC3CCC(Nc4cccc(Cl)c4)CC3)n2)n[nH]1 |
| InChI | InChI=1S/C21H25ClN6/c1-14-11-21(28-27-14)26-19-9-10-23-20(25-19)12-15-5-7-17(8-6-15)24-18-4-2-3-16(22)13-18/h2-4,9-11,13,15,17,24H,5-8,12H2,1H3,(H2,23,25,26,27,28) |
| InChIKey | JCLVRDCGCSUPSE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |