C12H24O2Si — CID 11009724
tert-butyl-[(1E,3Z)-1-methoxypenta-1,3-dien-3-yl]oxy-dimethylsilane (PubChem CID 11009724) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is tert-butyl-[(1E,3Z)-1-methoxypenta-1,3-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3Z)-1-methoxypenta-1,3-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11009724 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl-[(1E,3Z)-1-methoxypenta-1,3-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C(/C=C/OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O2Si/c1-8-11(9-10-13-5)14-15(6,7)12(2,3)4/h8-10H,1-7H3/b10-9+,11-8- |
| InChIKey | LVBNCGTVVYRYFT-PGGWCAKNSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|