C22H39N3O3 — CID 110098093
N-[1-[[1-(2-cyclohexylacetyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 110098093) has the molecular formula C22H39N3O3 and a molecular weight of 393.57 g/mol. Its IUPAC name is N-[1-[[1-(2-cyclohexylacetyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[1-(2-cyclohexylacetyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 110098093 |
| Molecular Formula | C22H39N3O3 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | N-[1-[[1-(2-cyclohexylacetyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(CC2(O)CCCN(C(=O)CC3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C22H39N3O3/c1-18(26)23-20-8-13-24(14-9-20)17-22(28)10-5-12-25(15-11-22)21(27)16-19-6-3-2-4-7-19/h19-20,28H,2-17H2,1H3,(H,23,26) |
| InChIKey | UXZHYOWDAPHADJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |