C23H35N3O4 — CID 110123234
N-[1-[[4-hydroxy-1-[2-(4-methoxyphenyl)acetyl]azepan-4-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 110123234) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[1-[[4-hydroxy-1-[2-(4-methoxyphenyl)acetyl]azepan-4-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[4-hydroxy-1-[2-(4-methoxyphenyl)acetyl]azepan-4-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 110123234 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[1-[[4-hydroxy-1-[2-(4-methoxyphenyl)acetyl]azepan-4-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | COc1ccc(CC(=O)N2CCCC(O)(CN3CCC(NC(C)=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O4/c1-18(27)24-20-8-13-25(14-9-20)17-23(29)10-3-12-26(15-11-23)22(28)16-19-4-6-21(30-2)7-5-19/h4-7,20,29H,3,8-17H2,1-2H3,(H,24,27) |
| InChIKey | MZCZGABRWNMHLH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |