About 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one
4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one (PubChem CID 110099004) has the molecular formula C20H24N4O4S
and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one |
| PubChem CID | 110099004 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one |
| SMILES | CS(=O)(=O)N1CCC(c2cnc(N3C(=O)OCC3Cc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C20H24N4O4S/c1-29(26,27)23-9-7-16(8-10-23)18-12-22-19(13-21-18)24-17(14-28-20(24)25)11-15-5-3-2-4-6-15/h2-6,12-13,16-17H,7-11,14H2,1H3 |
| InChIKey | VEOSBJCEKDBRCQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one?
The IUPAC name of 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one (CID 110099004) is 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one is CS(=O)(=O)N1CCC(c2cnc(N3C(=O)OCC3Cc3ccccc3)cn2)CC1.
What is the InChIKey of 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one?
The InChIKey is VEOSBJCEKDBRCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O4S/c1-29(26,27)23-9-7-16(8-10-23)18-12-22-19(13-21-18)24-17(14-28-20(24)25)11-15-5-3-2-4-6-15/h2-6,12-13,16-17H,7-11,14H2,1H3.
What are the key properties of 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one?
4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one has a molecular weight of 416.50 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-[5-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 110099004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).