C17H14N2O2 — CID 140783510
(4S)-4-benzyl-3-(4-isocyanophenyl)-1,3-oxazolidin-2-one (PubChem CID 140783510) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(4-isocyanophenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(4-isocyanophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140783510 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (4S)-4-benzyl-3-(4-isocyanophenyl)-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)OC[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H14N2O2/c1-18-14-7-9-15(10-8-14)19-16(12-21-17(19)20)11-13-5-3-2-4-6-13/h2-10,16H,11-12H2/t16-/m0/s1 |
| InChIKey | PLBNTMVUZSZANB-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|