About 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one
3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one (PubChem CID 110099044) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one |
| PubChem CID | 110099044 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)C(=O)N1CCCC(c2cncc(N3CCOC3=O)n2)C1 |
| InChI | InChI=1S/C17H24N4O3/c1-17(2,3)15(22)20-6-4-5-12(11-20)13-9-18-10-14(19-13)21-7-8-24-16(21)23/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | XMAGSLWOFMBRJC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one (CID 110099044) is 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one is CC(C)(C)C(=O)N1CCCC(c2cncc(N3CCOC3=O)n2)C1.
What is the InChIKey of 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one?
The InChIKey is XMAGSLWOFMBRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O3/c1-17(2,3)15(22)20-6-4-5-12(11-20)13-9-18-10-14(19-13)21-7-8-24-16(21)23/h9-10,12H,4-8,11H2,1-3H3.
What are the key properties of 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one?
3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one has a molecular weight of 332.40 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-[1-(2,2-dimethylpropanoyl)piperidin-3-yl]pyrazin-2-yl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 110099044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).