C20H21N5O — CID 110099532
[2-[6-(1H-imidazol-2-yl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-phenylmethanone (PubChem CID 110099532) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is [2-[6-(1H-imidazol-2-yl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [2-[6-(1H-imidazol-2-yl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110099532 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-[6-(1H-imidazol-2-yl)-2-methylpyrimidin-4-yl]piperidin-1-yl]-phenylmethanone |
| SMILES | Cc1nc(-c2ncc[nH]2)cc(C2CCCCN2C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N5O/c1-14-23-16(13-17(24-14)19-21-10-11-22-19)18-9-5-6-12-25(18)20(26)15-7-3-2-4-8-15/h2-4,7-8,10-11,13,18H,5-6,9,12H2,1H3,(H,21,22) |
| InChIKey | HVWITMPVAHEJFI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |