C15H19N5O — CID 124970677
1-[(2R)-2-[2-methyl-6-(1H-pyrazol-5-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 124970677) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[(2R)-2-[2-methyl-6-(1H-pyrazol-5-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[2-methyl-6-(1H-pyrazol-5-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124970677 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-[(2R)-2-[2-methyl-6-(1H-pyrazol-5-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC[C@@H]1c1cc(-c2ccn[nH]2)nc(C)n1 |
| InChI | InChI=1S/C15H19N5O/c1-10-17-13(12-6-7-16-19-12)9-14(18-10)15-5-3-4-8-20(15)11(2)21/h6-7,9,15H,3-5,8H2,1-2H3,(H,16,19)/t15-/m1/s1 |
| InChIKey | JRQOXMOHQRXGIC-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |