C16H21N5O — CID 110101187
1-[2-[2-methyl-6-(2-methylpyrazol-3-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 110101187) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-[2-[2-methyl-6-(2-methylpyrazol-3-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[2-[2-methyl-6-(2-methylpyrazol-3-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110101187 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-[2-[2-methyl-6-(2-methylpyrazol-3-yl)pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCCC1c1cc(-c2ccnn2C)nc(C)n1 |
| InChI | InChI=1S/C16H21N5O/c1-11-18-13(15-7-8-17-20(15)3)10-14(19-11)16-6-4-5-9-21(16)12(2)22/h7-8,10,16H,4-6,9H2,1-3H3 |
| InChIKey | NIQBWZLYLAVAEL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |