C19H20N4O2 — CID 110102686
(2-methyl-3H-benzimidazol-5-yl)-[2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone (PubChem CID 110102686) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (2-methyl-3H-benzimidazol-5-yl)-[2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone.
| Compound Name | (2-methyl-3H-benzimidazol-5-yl)-[2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110102686 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (2-methyl-3H-benzimidazol-5-yl)-[2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone |
| SMILES | Cc1cc(C2CN(C(=O)c3ccc4nc(C)[nH]c4c3)CCO2)ccn1 |
| InChI | InChI=1S/C19H20N4O2/c1-12-9-14(5-6-20-12)18-11-23(7-8-25-18)19(24)15-3-4-16-17(10-15)22-13(2)21-16/h3-6,9-10,18H,7-8,11H2,1-2H3,(H,21,22) |
| InChIKey | DOOAODFOTNEEAW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |