C17H19N3O2 — CID 110102771
6-[4-(pyridin-4-ylmethyl)piperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 110102771) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 6-[4-(pyridin-4-ylmethyl)piperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-[4-(pyridin-4-ylmethyl)piperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 110102771 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-[4-(pyridin-4-ylmethyl)piperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CCC(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C17H19N3O2/c21-16-3-1-2-15(19-16)17(22)20-10-6-14(7-11-20)12-13-4-8-18-9-5-13/h1-5,8-9,14H,6-7,10-12H2,(H,19,21) |
| InChIKey | MOZWAPIICFNVOY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |