C10H12N2O3 — CID 107262059
6-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 107262059) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 107262059 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C10H12N2O3/c13-7-4-5-12(6-7)10(15)8-2-1-3-9(14)11-8/h1-3,7,13H,4-6H2,(H,11,14)/t7-/m0/s1 |
| InChIKey | HWWYBLJLWIRJLU-ZETCQYMHSA-N |
| XLogP | -0.42 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |