C12H13N3O2 — CID 114040125
1-(6-oxo-1H-pyridine-2-carbonyl)piperidine-3-carbonitrile (PubChem CID 114040125) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(6-oxo-1H-pyridine-2-carbonyl)piperidine-3-carbonitrile.
| Compound Name | 1-(6-oxo-1H-pyridine-2-carbonyl)piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 114040125 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-(6-oxo-1H-pyridine-2-carbonyl)piperidine-3-carbonitrile |
| SMILES | N#CC1CCCN(C(=O)c2cccc(=O)[nH]2)C1 |
| InChI | InChI=1S/C12H13N3O2/c13-7-9-3-2-6-15(8-9)12(17)10-4-1-5-11(16)14-10/h1,4-5,9H,2-3,6,8H2,(H,14,16) |
| InChIKey | KDEHFQPGTALRSQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |