C13H18N2O2 — CID 114040424
6-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 114040424) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 114040424 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 6-[(2S,6R)-2,6-dimethylpiperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1C(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-5-3-6-10(2)15(9)13(17)11-7-4-8-12(16)14-11/h4,7-10H,3,5-6H2,1-2H3,(H,14,16)/t9-,10+ |
| InChIKey | SGYUSKIDTIWMHX-AOOOYVTPSA-N |
| XLogP | 1.78 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |