C12H16N2O2S — CID 114040378
6-(2,6-dimethylthiomorpholine-4-carbonyl)-1H-pyridin-2-one (PubChem CID 114040378) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 114040378 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-(2,6-dimethylthiomorpholine-4-carbonyl)-1H-pyridin-2-one |
| SMILES | CC1CN(C(=O)c2cccc(=O)[nH]2)CC(C)S1 |
| InChI | InChI=1S/C12H16N2O2S/c1-8-6-14(7-9(2)17-8)12(16)10-4-3-5-11(15)13-10/h3-5,8-9H,6-7H2,1-2H3,(H,13,15) |
| InChIKey | CSVMQLLUCWMUFS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |