C12H14N2O2 — CID 106316330
6-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1H-pyridin-2-one (PubChem CID 106316330) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106316330 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1H-pyridin-2-one |
| SMILES | CC1=CCCN(C(=O)c2cccc(=O)[nH]2)C1 |
| InChI | InChI=1S/C12H14N2O2/c1-9-4-3-7-14(8-9)12(16)10-5-2-6-11(15)13-10/h2,4-6H,3,7-8H2,1H3,(H,13,15) |
| InChIKey | LQJJQTPBTQIETP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|