C10H12N2O4 — CID 66260859
6-hydroxy-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 66260859) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-hydroxy-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-hydroxy-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 66260859 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-hydroxy-4-[(3R)-3-hydroxypyrrolidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cc(O)[nH]c(=O)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C10H12N2O4/c13-7-1-2-12(5-7)10(16)6-3-8(14)11-9(15)4-6/h3-4,7,13H,1-2,5H2,(H2,11,14,15)/t7-/m1/s1 |
| InChIKey | WPWNJHVESWFUBL-SSDOTTSWSA-N |
| XLogP | -0.71 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |