C17H19N3OS — CID 110105450
4-(1-benzothiophen-2-ylmethyl)-3-(5-methyl-1H-imidazol-2-yl)morpholine (PubChem CID 110105450) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-ylmethyl)-3-(5-methyl-1H-imidazol-2-yl)morpholine.
| Compound Name | 4-(1-benzothiophen-2-ylmethyl)-3-(5-methyl-1H-imidazol-2-yl)morpholine |
|---|---|
| PubChem CID | 110105450 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-(1-benzothiophen-2-ylmethyl)-3-(5-methyl-1H-imidazol-2-yl)morpholine |
| SMILES | Cc1cnc(C2COCCN2Cc2cc3ccccc3s2)[nH]1 |
| InChI | InChI=1S/C17H19N3OS/c1-12-9-18-17(19-12)15-11-21-7-6-20(15)10-14-8-13-4-2-3-5-16(13)22-14/h2-5,8-9,15H,6-7,10-11H2,1H3,(H,18,19) |
| InChIKey | GBTZSNHMBZNPIV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |