C21H19ClN4OS — CID 162822083
3-[5-(5-chlorothiophen-2-yl)-1H-imidazol-2-yl]-4-(quinolin-3-ylmethyl)morpholine (PubChem CID 162822083) has the molecular formula C21H19ClN4OS and a molecular weight of 410.93 g/mol. Its IUPAC name is 3-[5-(5-chlorothiophen-2-yl)-1H-imidazol-2-yl]-4-(quinolin-3-ylmethyl)morpholine.
| Compound Name | 3-[5-(5-chlorothiophen-2-yl)-1H-imidazol-2-yl]-4-(quinolin-3-ylmethyl)morpholine |
|---|---|
| PubChem CID | 162822083 |
| Molecular Formula | C21H19ClN4OS |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[5-(5-chlorothiophen-2-yl)-1H-imidazol-2-yl]-4-(quinolin-3-ylmethyl)morpholine |
| SMILES | Clc1ccc(-c2cnc(C3COCCN3Cc3cnc4ccccc4c3)[nH]2)s1 |
| InChI | InChI=1S/C21H19ClN4OS/c22-20-6-5-19(28-20)17-11-24-21(25-17)18-13-27-8-7-26(18)12-14-9-15-3-1-2-4-16(15)23-10-14/h1-6,9-11,18H,7-8,12-13H2,(H,24,25) |
| InChIKey | VHIGPYUXYSBXAD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |