C15H30N4O2 — CID 110108761
1-[3-[(dimethylamino)methyl]-3-hydroxypyrrolidin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 110108761) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-3-hydroxypyrrolidin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 1-[3-[(dimethylamino)methyl]-3-hydroxypyrrolidin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110108761 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-3-hydroxypyrrolidin-1-yl]-2-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(CC(=O)N2CCC(O)(CN(C)C)C2)CC1 |
| InChI | InChI=1S/C15H30N4O2/c1-4-17-7-9-18(10-8-17)11-14(20)19-6-5-15(21,13-19)12-16(2)3/h21H,4-13H2,1-3H3 |
| InChIKey | SAFFZYGTNHGCCA-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |