About 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride
1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride (PubChem CID 154888181) has the molecular formula C17H34Cl2N4O
and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride.
Molecular Properties
| Compound Name | 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride |
| PubChem CID | 154888181 |
| Molecular Formula | C17H34Cl2N4O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride |
| SMILES | CCN1CCN(CC(=O)N2CCC3(CCNCC3)CC2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H32N4O.2ClH/c1-2-19-11-13-20(14-12-19)15-16(22)21-9-5-17(6-10-21)3-7-18-8-4-17;;/h18H,2-15H2,1H3;2*1H |
| InChIKey | QVBZQFPOHFBPPT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride?
The IUPAC name of 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride (CID 154888181) is 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride.
What is the SMILES notation for 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride?
The canonical SMILES for 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride is CCN1CCN(CC(=O)N2CCC3(CCNCC3)CC2)CC1.Cl.Cl.
What is the InChIKey of 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride?
The InChIKey is QVBZQFPOHFBPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4O.2ClH/c1-2-19-11-13-20(14-12-19)15-16(22)21-9-5-17(6-10-21)3-7-18-8-4-17;;/h18H,2-15H2,1H3;2*1H.
What are the key properties of 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride?
1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride has a molecular weight of 381.39 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(4-ethylpiperazin-1-yl)ethanone;dihydrochloride is sourced from PubChem (CID 154888181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).