C15H18N4O3 — CID 110109127
3-[2-oxo-2-(2-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 110109127) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[2-oxo-2-(2-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(2-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 110109127 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-[2-oxo-2-(2-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CC(=O)N1CCNCC1c1ccccc1 |
| InChI | InChI=1S/C15H18N4O3/c20-13-9-17-15(22)19(13)10-14(21)18-7-6-16-8-12(18)11-4-2-1-3-5-11/h1-5,12,16H,6-10H2,(H,17,22) |
| InChIKey | MOLGVEBQALBHDJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|