C16H18N2OS — CID 125022040
1-[(2R)-2-phenylpiperazin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 125022040) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-[(2R)-2-phenylpiperazin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(2R)-2-phenylpiperazin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 125022040 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[(2R)-2-phenylpiperazin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCNC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18N2OS/c19-16(10-13-6-9-20-12-13)18-8-7-17-11-15(18)14-4-2-1-3-5-14/h1-6,9,12,15,17H,7-8,10-11H2/t15-/m0/s1 |
| InChIKey | YNWNXJHCZVFXSQ-HNNXBMFYSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |