C16H19N3OS — CID 110109188
1-[3-phenyl-4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 110109188) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-[3-phenyl-4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[3-phenyl-4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110109188 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[3-phenyl-4-(1,3-thiazol-4-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2cscn2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H19N3OS/c1-13(20)18-7-8-19(9-15-11-21-12-17-15)16(10-18)14-5-3-2-4-6-14/h2-6,11-12,16H,7-10H2,1H3 |
| InChIKey | OJVCPAYWYNQNIJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |