C17H22N4O — CID 124953208
1-[(3R)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-3-phenylpiperazin-1-yl]ethanone (PubChem CID 124953208) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(3R)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-3-phenylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(3R)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-3-phenylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 124953208 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[(3R)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-3-phenylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2nc[nH]c2C)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N4O/c1-13-16(19-12-18-13)10-21-9-8-20(14(2)22)11-17(21)15-6-4-3-5-7-15/h3-7,12,17H,8-11H2,1-2H3,(H,18,19)/t17-/m0/s1 |
| InChIKey | DTXPKCGTCHVTCD-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |