C20H23FN4O2 — CID 110110360
6-[[1-[2-(4-fluorophenyl)acetyl]azepan-4-yl]methyl]pyrimidine-4-carboxamide (PubChem CID 110110360) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 6-[[1-[2-(4-fluorophenyl)acetyl]azepan-4-yl]methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[[1-[2-(4-fluorophenyl)acetyl]azepan-4-yl]methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 110110360 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 6-[[1-[2-(4-fluorophenyl)acetyl]azepan-4-yl]methyl]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(CC2CCCN(C(=O)Cc3ccc(F)cc3)CC2)ncn1 |
| InChI | InChI=1S/C20H23FN4O2/c21-16-5-3-15(4-6-16)11-19(26)25-8-1-2-14(7-9-25)10-17-12-18(20(22)27)24-13-23-17/h3-6,12-14H,1-2,7-11H2,(H2,22,27) |
| InChIKey | SIXLPZBWVIVMRI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |