C17H22N6O — CID 124947582
6-[[(4S)-1-(pyrazin-2-ylmethyl)azepan-4-yl]methyl]pyrimidine-4-carboxamide (PubChem CID 124947582) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-[[(4S)-1-(pyrazin-2-ylmethyl)azepan-4-yl]methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[[(4S)-1-(pyrazin-2-ylmethyl)azepan-4-yl]methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 124947582 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 6-[[(4S)-1-(pyrazin-2-ylmethyl)azepan-4-yl]methyl]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(C[C@H]2CCCN(Cc3cnccn3)CC2)ncn1 |
| InChI | InChI=1S/C17H22N6O/c18-17(24)16-9-14(21-12-22-16)8-13-2-1-6-23(7-3-13)11-15-10-19-4-5-20-15/h4-5,9-10,12-13H,1-3,6-8,11H2,(H2,18,24)/t13-/m0/s1 |
| InChIKey | CGQQRHJCPSZFAL-ZDUSSCGKSA-N |
| XLogP | 1.21 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |