C22H20N6O — CID 110110907
[4-[3-(1H-imidazol-2-yl)pyrazin-2-yl]piperidin-1-yl]-quinolin-3-ylmethanone (PubChem CID 110110907) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is [4-[3-(1H-imidazol-2-yl)pyrazin-2-yl]piperidin-1-yl]-quinolin-3-ylmethanone.
| Compound Name | [4-[3-(1H-imidazol-2-yl)pyrazin-2-yl]piperidin-1-yl]-quinolin-3-ylmethanone |
|---|---|
| PubChem CID | 110110907 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [4-[3-(1H-imidazol-2-yl)pyrazin-2-yl]piperidin-1-yl]-quinolin-3-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2c1)N1CCC(c2nccnc2-c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C22H20N6O/c29-22(17-13-16-3-1-2-4-18(16)27-14-17)28-11-5-15(6-12-28)19-20(24-8-7-23-19)21-25-9-10-26-21/h1-4,7-10,13-15H,5-6,11-12H2,(H,25,26) |
| InChIKey | KMAQAKQRWVEIPD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |