C14H15NO3S — CID 11011295
5-methoxy-4-(methylamino)-3-(1-thiophen-2-ylethyl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 11011295) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 5-methoxy-4-(methylamino)-3-(1-thiophen-2-ylethyl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-methoxy-4-(methylamino)-3-(1-thiophen-2-ylethyl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 11011295 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-methoxy-4-(methylamino)-3-(1-thiophen-2-ylethyl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CNC1=C(C(C)c2cccs2)C(=O)C(=O)C=C1OC |
| InChI | InChI=1S/C14H15NO3S/c1-8(11-5-4-6-19-11)12-13(15-2)10(18-3)7-9(16)14(12)17/h4-8,15H,1-3H3 |
| InChIKey | NHPWCJLVTKLCTB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|