C16H24N6O — CID 110113016
N-methyl-3-[4-[(1-propylpyrazol-4-yl)methyl]morpholin-2-yl]pyrazin-2-amine (PubChem CID 110113016) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is N-methyl-3-[4-[(1-propylpyrazol-4-yl)methyl]morpholin-2-yl]pyrazin-2-amine.
| Compound Name | N-methyl-3-[4-[(1-propylpyrazol-4-yl)methyl]morpholin-2-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 110113016 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-methyl-3-[4-[(1-propylpyrazol-4-yl)methyl]morpholin-2-yl]pyrazin-2-amine |
| SMILES | CCCn1cc(CN2CCOC(c3nccnc3NC)C2)cn1 |
| InChI | InChI=1S/C16H24N6O/c1-3-6-22-11-13(9-20-22)10-21-7-8-23-14(12-21)15-16(17-2)19-5-4-18-15/h4-5,9,11,14H,3,6-8,10,12H2,1-2H3,(H,17,19) |
| InChIKey | MDLFITPRRJFJAO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |