C17H24N4O — CID 127245697
2-(5-methyl-2-pyridinyl)-4-[(1-propylpyrazol-4-yl)methyl]morpholine (PubChem CID 127245697) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)-4-[(1-propylpyrazol-4-yl)methyl]morpholine.
| Compound Name | 2-(5-methyl-2-pyridinyl)-4-[(1-propylpyrazol-4-yl)methyl]morpholine |
|---|---|
| PubChem CID | 127245697 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)-4-[(1-propylpyrazol-4-yl)methyl]morpholine |
| SMILES | CCCn1cc(CN2CCOC(c3ccc(C)cn3)C2)cn1 |
| InChI | InChI=1S/C17H24N4O/c1-3-6-21-12-15(10-19-21)11-20-7-8-22-17(13-20)16-5-4-14(2)9-18-16/h4-5,9-10,12,17H,3,6-8,11,13H2,1-2H3 |
| InChIKey | JDLKSPGZJYDLHA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |