C17H32OSi — CID 11011416
tert-butyl-dimethyl-(2,5,5-trimethyloct-1-en-7-yn-4-yloxy)silane (PubChem CID 11011416) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,5,5-trimethyloct-1-en-7-yn-4-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,5,5-trimethyloct-1-en-7-yn-4-yloxy)silane |
|---|---|
| PubChem CID | 11011416 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl-dimethyl-(2,5,5-trimethyloct-1-en-7-yn-4-yloxy)silane |
| SMILES | C#CCC(C)(C)C(CC(=C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32OSi/c1-11-12-17(7,8)15(13-14(2)3)18-19(9,10)16(4,5)6/h1,15H,2,12-13H2,3-10H3 |
| InChIKey | LSSKRMLZXODMTL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|