C25H44O3Si — CID 11144282
[9,9-bis(methoxymethyl)-2,4,4-trimethyldodec-1-en-6,11-diyn-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11144282) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is [9,9-bis(methoxymethyl)-2,4,4-trimethyldodec-1-en-6,11-diyn-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [9,9-bis(methoxymethyl)-2,4,4-trimethyldodec-1-en-6,11-diyn-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11144282 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | [9,9-bis(methoxymethyl)-2,4,4-trimethyldodec-1-en-6,11-diyn-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CCC(CC#CC(O[Si](C)(C)C(C)(C)C)C(C)(C)CC(=C)C)(COC)COC |
| InChI | InChI=1S/C25H44O3Si/c1-13-16-25(19-26-9,20-27-10)17-14-15-22(24(7,8)18-21(2)3)28-29(11,12)23(4,5)6/h1,22H,2,16-20H2,3-12H3 |
| InChIKey | QHKQYVYSGPALTQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|