C20H22FN3O2 — CID 110116390
[1-(2-fluorophenyl)cyclopropyl]-[2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone (PubChem CID 110116390) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is [1-(2-fluorophenyl)cyclopropyl]-[2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)cyclopropyl]-[2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110116390 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | [1-(2-fluorophenyl)cyclopropyl]-[2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone |
| SMILES | O=C(N1CCOC(CCc2ccncn2)C1)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c21-18-4-2-1-3-17(18)20(8-9-20)19(25)24-11-12-26-16(13-24)6-5-15-7-10-22-14-23-15/h1-4,7,10,14,16H,5-6,8-9,11-13H2 |
| InChIKey | WWADQDSGKOMLGS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |