C20H26N4O — CID 110116877
[4-[[5-[(dimethylamino)methyl]pyrazin-2-yl]methyl]piperidin-1-yl]-phenylmethanone (PubChem CID 110116877) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is [4-[[5-[(dimethylamino)methyl]pyrazin-2-yl]methyl]piperidin-1-yl]-phenylmethanone.
| Compound Name | [4-[[5-[(dimethylamino)methyl]pyrazin-2-yl]methyl]piperidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110116877 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [4-[[5-[(dimethylamino)methyl]pyrazin-2-yl]methyl]piperidin-1-yl]-phenylmethanone |
| SMILES | CN(C)Cc1cnc(CC2CCN(C(=O)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C20H26N4O/c1-23(2)15-19-14-21-18(13-22-19)12-16-8-10-24(11-9-16)20(25)17-6-4-3-5-7-17/h3-7,13-14,16H,8-12,15H2,1-2H3 |
| InChIKey | XVQIDYZIYNLFAY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |