C18H24N4OS — CID 124943319
[(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-thiophen-2-ylmethanone (PubChem CID 124943319) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is [(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 124943319 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-thiophen-2-ylmethanone |
| SMILES | CN(C)c1cnc(C[C@H]2CCCN(C(=O)c3cccs3)CC2)cn1 |
| InChI | InChI=1S/C18H24N4OS/c1-21(2)17-13-19-15(12-20-17)11-14-5-3-8-22(9-7-14)18(23)16-6-4-10-24-16/h4,6,10,12-14H,3,5,7-9,11H2,1-2H3/t14-/m0/s1 |
| InChIKey | BBPZINHWNPXFBG-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |