C18H26N6O — CID 124949477
1-[(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-2-imidazol-1-ylethanone (PubChem CID 124949477) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-[(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-2-imidazol-1-ylethanone.
| Compound Name | 1-[(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-2-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 124949477 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[(4S)-4-[[5-(dimethylamino)pyrazin-2-yl]methyl]azepan-1-yl]-2-imidazol-1-ylethanone |
| SMILES | CN(C)c1cnc(C[C@H]2CCCN(C(=O)Cn3ccnc3)CC2)cn1 |
| InChI | InChI=1S/C18H26N6O/c1-22(2)17-12-20-16(11-21-17)10-15-4-3-7-24(8-5-15)18(25)13-23-9-6-19-14-23/h6,9,11-12,14-15H,3-5,7-8,10,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | CUKFCPFIQOHSHR-HNNXBMFYSA-N |
| XLogP | 1.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |