C17H20N4O2S — CID 125001293
N-methyl-6-[[(3S)-1-(thiophene-2-carbonyl)piperidin-3-yl]methyl]pyrimidine-4-carboxamide (PubChem CID 125001293) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-methyl-6-[[(3S)-1-(thiophene-2-carbonyl)piperidin-3-yl]methyl]pyrimidine-4-carboxamide.
| Compound Name | N-methyl-6-[[(3S)-1-(thiophene-2-carbonyl)piperidin-3-yl]methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 125001293 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-methyl-6-[[(3S)-1-(thiophene-2-carbonyl)piperidin-3-yl]methyl]pyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1cc(C[C@@H]2CCCN(C(=O)c3cccs3)C2)ncn1 |
| InChI | InChI=1S/C17H20N4O2S/c1-18-16(22)14-9-13(19-11-20-14)8-12-4-2-6-21(10-12)17(23)15-5-3-7-24-15/h3,5,7,9,11-12H,2,4,6,8,10H2,1H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | SCFJUDVEQGAGIL-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |